C14H8BrCl2FN2O2 — CID 46652348
N'-(2-bromobenzoyl)-2,4-dichloro-5-fluorobenzohydrazide (PubChem CID 46652348) has the molecular formula C14H8BrCl2FN2O2 and a molecular weight of 406.04 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-2,4-dichloro-5-fluorobenzohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-2,4-dichloro-5-fluorobenzohydrazide |
|---|---|
| PubChem CID | 46652348 |
| Molecular Formula | C14H8BrCl2FN2O2 |
| Molecular Weight | 406.04 g/mol |
| Exact Mass | 403.91 |
| IUPAC Name | N'-(2-bromobenzoyl)-2,4-dichloro-5-fluorobenzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1Br)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H8BrCl2FN2O2/c15-9-4-2-1-3-7(9)13(21)19-20-14(22)8-5-12(18)11(17)6-10(8)16/h1-6H,(H,19,21)(H,20,22) |
| InChIKey | SUMSCPMBMYMEQK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.04 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|