C12H6BrCl2FN2O — CID 75390644
N-(3-bromo-4-pyridinyl)-2,4-dichloro-5-fluorobenzamide (PubChem CID 75390644) has the molecular formula C12H6BrCl2FN2O and a molecular weight of 364.00 g/mol. Its IUPAC name is N-(3-bromo-4-pyridinyl)-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-(3-bromo-4-pyridinyl)-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 75390644 |
| Molecular Formula | C12H6BrCl2FN2O |
| Molecular Weight | 364.00 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | N-(3-bromo-4-pyridinyl)-2,4-dichloro-5-fluorobenzamide |
| SMILES | O=C(Nc1ccncc1Br)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H6BrCl2FN2O/c13-7-5-17-2-1-11(7)18-12(19)6-3-10(16)9(15)4-8(6)14/h1-5H,(H,17,18,19) |
| InChIKey | NCTBPPVINSTFKZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.00 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|