C13H9BrClFN2O — CID 103280869
N-(5-bromo-4-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide (PubChem CID 103280869) has the molecular formula C13H9BrClFN2O and a molecular weight of 343.58 g/mol. Its IUPAC name is N-(5-bromo-4-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide.
| Compound Name | N-(5-bromo-4-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103280869 |
| Molecular Formula | C13H9BrClFN2O |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | N-(5-bromo-4-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)c1cnccc1Cl |
| InChI | InChI=1S/C13H9BrClFN2O/c1-7-4-11(16)9(14)5-12(7)18-13(19)8-6-17-3-2-10(8)15/h2-6H,1H3,(H,18,19) |
| InChIKey | GVJDUXBQTUTCIV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |