C12H11BrFN3O — CID 103274927
N-(5-bromo-4-fluoro-2-methylphenyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 103274927) has the molecular formula C12H11BrFN3O and a molecular weight of 312.14 g/mol. Its IUPAC name is N-(5-bromo-4-fluoro-2-methylphenyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(5-bromo-4-fluoro-2-methylphenyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103274927 |
| Molecular Formula | C12H11BrFN3O |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-(5-bromo-4-fluoro-2-methylphenyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C12H11BrFN3O/c1-6-3-10(14)9(13)4-11(6)16-12(18)8-5-15-17-7(8)2/h3-5H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | XQFRQWXQJKIBCS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |