C11H8BrCl2N3O — CID 107792769
N-(4-bromo-2,3-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 107792769) has the molecular formula C11H8BrCl2N3O and a molecular weight of 349.02 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107792769 |
| Molecular Formula | C11H8BrCl2N3O |
| Molecular Weight | 349.02 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H8BrCl2N3O/c1-5-6(4-15-17-5)11(18)16-8-3-2-7(12)9(13)10(8)14/h2-4H,1H3,(H,15,17)(H,16,18) |
| InChIKey | RCBKAMGIUJTIFC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|