C11H9BrCl2N4O — CID 107792556
5-amino-N-(4-bromo-2,3-dichlorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 107792556) has the molecular formula C11H9BrCl2N4O and a molecular weight of 364.03 g/mol. Its IUPAC name is 5-amino-N-(4-bromo-2,3-dichlorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-bromo-2,3-dichlorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107792556 |
| Molecular Formula | C11H9BrCl2N4O |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 5-amino-N-(4-bromo-2,3-dichlorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)Nc2ccc(Br)c(Cl)c2Cl)c1N |
| InChI | InChI=1S/C11H9BrCl2N4O/c1-18-10(15)5(4-16-18)11(19)17-7-3-2-6(12)8(13)9(7)14/h2-4H,15H2,1H3,(H,17,19) |
| InChIKey | SQTAMAZMGSDBDP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|