C11H11BrN4O — CID 80504044
5-amino-N-(4-bromophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 80504044) has the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. Its IUPAC name is 5-amino-N-(4-bromophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-bromophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 80504044 |
| Molecular Formula | C11H11BrN4O |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 5-amino-N-(4-bromophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)Nc2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C11H11BrN4O/c1-16-10(13)9(6-14-16)11(17)15-8-4-2-7(12)3-5-8/h2-6H,13H2,1H3,(H,15,17) |
| InChIKey | VBBGMDYFFZNGBU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |