C11H9Br2N3O — CID 107602580
N-(2,6-dibromophenyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 107602580) has the molecular formula C11H9Br2N3O and a molecular weight of 359.02 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2,6-dibromophenyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107602580 |
| Molecular Formula | C11H9Br2N3O |
| Molecular Weight | 359.02 g/mol |
| Exact Mass | 356.91 |
| IUPAC Name | N-(2,6-dibromophenyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C11H9Br2N3O/c1-6-7(5-14-16-6)11(17)15-10-8(12)3-2-4-9(10)13/h2-5H,1H3,(H,14,16)(H,15,17) |
| InChIKey | UYKUHOYPWRPZEU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.02 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |