C15H13BrCl2N2O — CID 107793571
N-(4-bromo-2,3-dichlorophenyl)-2-methyl-4-(methylamino)benzamide (PubChem CID 107793571) has the molecular formula C15H13BrCl2N2O and a molecular weight of 388.09 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-2-methyl-4-(methylamino)benzamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-2-methyl-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 107793571 |
| Molecular Formula | C15H13BrCl2N2O |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-2-methyl-4-(methylamino)benzamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc(Br)c(Cl)c2Cl)c(C)c1 |
| InChI | InChI=1S/C15H13BrCl2N2O/c1-8-7-9(19-2)3-4-10(8)15(21)20-12-6-5-11(16)13(17)14(12)18/h3-7,19H,1-2H3,(H,20,21) |
| InChIKey | PCFTXADNEZKSFA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|