C15H16N2O3 — CID 143020352
2,4-dihydroxy-N-[2-methyl-4-(methylamino)phenyl]benzamide (PubChem CID 143020352) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2,4-dihydroxy-N-[2-methyl-4-(methylamino)phenyl]benzamide.
| Compound Name | 2,4-dihydroxy-N-[2-methyl-4-(methylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 143020352 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2,4-dihydroxy-N-[2-methyl-4-(methylamino)phenyl]benzamide |
| SMILES | CNc1ccc(NC(=O)c2ccc(O)cc2O)c(C)c1 |
| InChI | InChI=1S/C15H16N2O3/c1-9-7-10(16-2)3-6-13(9)17-15(20)12-5-4-11(18)8-14(12)19/h3-8,16,18-19H,1-2H3,(H,17,20) |
| InChIKey | SCIQYZMBGCZAEV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |