C14H12INO3 — CID 113368797
2,4-dihydroxy-N-(3-iodo-2-methylphenyl)benzamide (PubChem CID 113368797) has the molecular formula C14H12INO3 and a molecular weight of 369.16 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(3-iodo-2-methylphenyl)benzamide.
| Compound Name | 2,4-dihydroxy-N-(3-iodo-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 113368797 |
| Molecular Formula | C14H12INO3 |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2,4-dihydroxy-N-(3-iodo-2-methylphenyl)benzamide |
| SMILES | Cc1c(I)cccc1NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H12INO3/c1-8-11(15)3-2-4-12(8)16-14(19)10-6-5-9(17)7-13(10)18/h2-7,17-18H,1H3,(H,16,19) |
| InChIKey | RYMDGWUQYLSVLR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|