C27H37N11O3 — CID 58948952
N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]-2,4-dihydroxybenzamide (PubChem CID 58948952) has the molecular formula C27H37N11O3 and a molecular weight of 563.67 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]-2,4-dihydroxybenzamide.
| Compound Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 58948952 |
| Molecular Formula | C27H37N11O3 |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]-2,4-dihydroxybenzamide |
| SMILES | Cc1cc(Nc2nc(N3C[C@H](N)C[C@H](N)C3)nc(N3C[C@H](N)C[C@H](N)C3)n2)ccc1NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C27H37N11O3/c1-14-6-19(2-5-22(14)33-24(41)21-4-3-20(39)9-23(21)40)32-25-34-26(37-10-15(28)7-16(29)11-37)36-27(35-25)38-12-17(30)8-18(31)13-38/h2-6,9,15-18,39-40H,7-8,10-13,28-31H2,1H3,(H,33,41)(H,32,34,35,36)/t15-,16+,17-,18+ |
| InChIKey | RBOLSORWRPVBTL-USTZCAOPSA-N |
| XLogP | 0.32 |
| TPSA | 230.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |