C30H37N11O2 — CID 58949068
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]naphthalene-2-carboxamide (PubChem CID 58949068) has the molecular formula C30H37N11O2 and a molecular weight of 583.70 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58949068 |
| Molecular Formula | C30H37N11O2 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]naphthalene-2-carboxamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4ccc5ccccc5c4)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C30H37N11O2/c31-20-10-21(32)14-40(13-20)29-37-28(38-30(39-29)41-15-22(33)11-23(34)16-41)35-24-7-8-25(26(42)12-24)36-27(43)19-6-5-17-3-1-2-4-18(17)9-19/h1-9,12,20-23,42H,10-11,13-16,31-34H2,(H,36,43)(H,35,37,38,39)/t20-,21+,22-,23+ |
| InChIKey | QAUJHGJXQNSRCO-MESAYYPLSA-N |
| XLogP | 1.46 |
| TPSA | 210.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|