C29H36N12O3 — CID 11215560
N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 11215560) has the molecular formula C29H36N12O3 and a molecular weight of 600.69 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 11215560 |
| Molecular Formula | C29H36N12O3 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)C(=O)c4c[nH]c5ccccc45)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C29H36N12O3/c30-15-7-16(31)12-40(11-15)28-37-27(38-29(39-28)41-13-17(32)8-18(33)14-41)35-19-5-6-23(24(42)9-19)36-26(44)25(43)21-10-34-22-4-2-1-3-20(21)22/h1-6,9-10,15-18,34,42H,7-8,11-14,30-33H2,(H,36,44)(H,35,37,38,39)/t15-,16+,17-,18+ |
| InChIKey | XPNKPPIJBWIXKU-USTZCAOPSA-N |
| XLogP | 0.35 |
| TPSA | 243.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|