C26H35N11O — CID 21104209
4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide (PubChem CID 21104209) has the molecular formula C26H35N11O and a molecular weight of 517.64 g/mol. Its IUPAC name is 4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide.
| Compound Name | 4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 21104209 |
| Molecular Formula | C26H35N11O |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-phenylbenzamide |
| SMILES | NC1CC(N)CN(c2nc(Nc3ccc(C(=O)Nc4ccccc4)cc3)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C26H35N11O/c27-17-10-18(28)13-36(12-17)25-33-24(34-26(35-25)37-14-19(29)11-20(30)15-37)32-22-8-6-16(7-9-22)23(38)31-21-4-2-1-3-5-21/h1-9,17-20H,10-15,27-30H2,(H,31,38)(H,32,33,34,35) |
| InChIKey | RTQRYARBIQRBMM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 190.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |