C30H38ClN11O2 — CID 45263750
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide;hydrochloride (PubChem CID 45263750) has the molecular formula C30H38ClN11O2 and a molecular weight of 620.16 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45263750 |
| Molecular Formula | C30H38ClN11O2 |
| Molecular Weight | 620.16 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4ccc5ccccc5c4O)cc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C30H37N11O2.ClH/c31-18-11-19(32)14-40(13-18)29-37-28(38-30(39-29)41-15-20(33)12-21(34)16-41)36-23-8-6-22(7-9-23)35-27(43)25-10-5-17-3-1-2-4-24(17)26(25)42;/h1-10,18-21,42H,11-16,31-34H2,(H,35,43)(H,36,37,38,39);1H/t18-,19+,20-,21+; |
| InChIKey | VYXAIFMBCUTMKW-FZPKMPHISA-N |
| XLogP | 1.88 |
| TPSA | 210.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |