C30H36N10O3 — CID 58949032
N-[4-[[4-[(2R,3R)-2-(aminomethyl)-3-hydroxypyrrolidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 58949032) has the molecular formula C30H36N10O3 and a molecular weight of 584.69 g/mol. Its IUPAC name is N-[4-[[4-[(2R,3R)-2-(aminomethyl)-3-hydroxypyrrolidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[4-[[4-[(2R,3R)-2-(aminomethyl)-3-hydroxypyrrolidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58949032 |
| Molecular Formula | C30H36N10O3 |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | N-[4-[[4-[(2R,3R)-2-(aminomethyl)-3-hydroxypyrrolidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | NC[C@@H]1[C@H](O)CCN1c1nc(Nc2ccc(NC(=O)c3ccc4ccccc4c3O)cc2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C30H36N10O3/c31-14-24-25(41)11-12-40(24)30-37-28(36-29(38-30)39-15-18(32)13-19(33)16-39)35-21-8-6-20(7-9-21)34-27(43)23-10-5-17-3-1-2-4-22(17)26(23)42/h1-10,18-19,24-25,41-42H,11-16,31-33H2,(H,34,43)(H,35,36,37,38)/t18-,19+,24-,25-/m1/s1 |
| InChIKey | BWIQYQPMDZBGFR-APTYZTEPSA-N |
| XLogP | 1.49 |
| TPSA | 204.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |