C26H35ClN12O5 — CID 158566010
N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-3-hydroxyphenyl]-2-hydroxy-3-nitrobenzamide;hydrochloride (PubChem CID 158566010) has the molecular formula C26H35ClN12O5 and a molecular weight of 631.10 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-3-hydroxyphenyl]-2-hydroxy-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-3-hydroxyphenyl]-2-hydroxy-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 158566010 |
| Molecular Formula | C26H35ClN12O5 |
| Molecular Weight | 631.10 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-3-hydroxyphenyl]-2-hydroxy-3-nitrobenzamide;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4cccc([N+](=O)[O-])c4O)cc3O)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H34N12O5.ClH/c27-13-6-14(28)10-36(9-13)25-33-24(34-26(35-25)37-11-15(29)7-16(30)12-37)32-19-5-4-17(8-21(19)39)31-23(41)18-2-1-3-20(22(18)40)38(42)43;/h1-5,8,13-16,39-40H,6-7,9-12,27-30H2,(H,31,41)(H,32,33,34,35);1H/t13-,14+,15-,16+; |
| InChIKey | FCWWFNXFPKQBAE-HHUWWSNMSA-N |
| XLogP | 0.34 |
| TPSA | 273.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.10 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|