C19H29N11O2 — CID 21103989
1-[4-(3,5-diaminopiperidin-1-yl)-6-(3-nitroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21103989) has the molecular formula C19H29N11O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 1-[4-(3,5-diaminopiperidin-1-yl)-6-(3-nitroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-(3-nitroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21103989 |
| Molecular Formula | C19H29N11O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-(3-nitroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | NC1CC(N)CN(c2nc(Nc3cccc([N+](=O)[O-])c3)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C19H29N11O2/c20-11-4-12(21)8-28(7-11)18-25-17(24-15-2-1-3-16(6-15)30(31)32)26-19(27-18)29-9-13(22)5-14(23)10-29/h1-3,6,11-14H,4-5,7-10,20-23H2,(H,24,25,26,27) |
| InChIKey | OTJSTUPPQMZMDG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|