C22H34N10 — CID 21104268
1-[4-(3,5-diaminopiperidin-1-yl)-6-(2,3-dihydro-1H-inden-5-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21104268) has the molecular formula C22H34N10 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[4-(3,5-diaminopiperidin-1-yl)-6-(2,3-dihydro-1H-inden-5-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-(2,3-dihydro-1H-inden-5-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21104268 |
| Molecular Formula | C22H34N10 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-(2,3-dihydro-1H-inden-5-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | NC1CC(N)CN(c2nc(Nc3ccc4c(c3)CCC4)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C22H34N10/c23-15-7-16(24)10-31(9-15)21-28-20(27-19-5-4-13-2-1-3-14(13)6-19)29-22(30-21)32-11-17(25)8-18(26)12-32/h4-6,15-18H,1-3,7-12,23-26H2,(H,27,28,29,30) |
| InChIKey | VXPYKTQPIXVMQF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |