C20H30N10O — CID 58949345
1-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3S,4R)-3,4-diaminopyrrolidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]ethanone (PubChem CID 58949345) has the molecular formula C20H30N10O and a molecular weight of 426.53 g/mol. Its IUPAC name is 1-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3S,4R)-3,4-diaminopyrrolidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3S,4R)-3,4-diaminopyrrolidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 58949345 |
| Molecular Formula | C20H30N10O |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 1-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3S,4R)-3,4-diaminopyrrolidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2nc(N3C[C@H](N)C[C@H](N)C3)nc(N3C[C@@H](N)[C@@H](N)C3)n2)cc1 |
| InChI | InChI=1S/C20H30N10O/c1-11(31)12-2-4-15(5-3-12)25-18-26-19(29-7-13(21)6-14(22)8-29)28-20(27-18)30-9-16(23)17(24)10-30/h2-5,13-14,16-17H,6-10,21-24H2,1H3,(H,25,26,27,28)/t13-,14+,16-,17+ |
| InChIKey | DPSXXCKEMUQBHE-MDBPOYHNSA-N |
| XLogP | -0.84 |
| TPSA | 178.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |