C22H34N10O2 — CID 58949392
ethyl 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 58949392) has the molecular formula C22H34N10O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is ethyl 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58949392 |
| Molecular Formula | C22H34N10O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | ethyl 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(N3C[C@H](N)C[C@H](N)C3)nc(N3C[C@H](N)C[C@H](N)C3)n2)cc1 |
| InChI | InChI=1S/C22H34N10O2/c1-2-34-19(33)13-3-5-18(6-4-13)27-20-28-21(31-9-14(23)7-15(24)10-31)30-22(29-20)32-11-16(25)8-17(26)12-32/h3-6,14-17H,2,7-12,23-26H2,1H3,(H,27,28,29,30)/t14-,15+,16-,17+ |
| InChIKey | ARVSZEIRHJQDDR-WNKDZCFJSA-N |
| XLogP | -0.48 |
| TPSA | 187.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |