C48H50N10O8 — CID 57313597
ethyl 4-[[4-[4-[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 57313597) has the molecular formula C48H50N10O8 and a molecular weight of 894.99 g/mol. Its IUPAC name is ethyl 4-[[4-[4-[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[4-[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 57313597 |
| Molecular Formula | C48H50N10O8 |
| Molecular Weight | 894.99 g/mol |
| Exact Mass | 894.38 |
| IUPAC Name | ethyl 4-[[4-[4-[4,6-bis(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(4-ethoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Nc3ccc(C(=O)OCC)cc3)nc(C3CCC(c4nc(Nc5ccc(C(=O)OCC)cc5)nc(Nc5ccc(C(=O)OCC)cc5)n4)CC3)n2)cc1 |
| InChI | InChI=1S/C48H50N10O8/c1-5-63-41(59)31-13-21-35(22-14-31)49-45-53-39(54-46(57-45)50-36-23-15-32(16-24-36)42(60)64-6-2)29-9-11-30(12-10-29)40-55-47(51-37-25-17-33(18-26-37)43(61)65-7-3)58-48(56-40)52-38-27-19-34(20-28-38)44(62)66-8-4/h13-30H,5-12H2,1-4H3,(H2,49,50,53,54,57)(H2,51,52,55,56,58) |
| InChIKey | RGQBMRCQXARIAS-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 230.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.99 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|