C19H24N6O2 — CID 171851129
methyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 171851129) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is methyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 171851129 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | methyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(C3CCNC3)nc(C3CCNC3)n2)cc1 |
| InChI | InChI=1S/C19H24N6O2/c1-27-18(26)12-2-4-15(5-3-12)22-19-24-16(13-6-8-20-10-13)23-17(25-19)14-7-9-21-11-14/h2-5,13-14,20-21H,6-11H2,1H3,(H,22,23,24,25) |
| InChIKey | YUYFYASPEKGOOV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |