C20H26N6O2 — CID 171851265
ethyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 171851265) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is ethyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 171851265 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl 4-[[4,6-di(pyrrolidin-3-yl)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(C3CCNC3)nc(C3CCNC3)n2)cc1 |
| InChI | InChI=1S/C20H26N6O2/c1-2-28-19(27)13-3-5-16(6-4-13)23-20-25-17(14-7-9-21-11-14)24-18(26-20)15-8-10-22-12-15/h3-6,14-15,21-22H,2,7-12H2,1H3,(H,23,24,25,26) |
| InChIKey | GAOGYAZQTJUOML-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |