C18H22N4O2 — CID 112884279
ethyl 4-[[4-(cyclopentylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112884279) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is ethyl 4-[[4-(cyclopentylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(cyclopentylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112884279 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | ethyl 4-[[4-(cyclopentylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nccc(NC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-24-17(23)13-7-9-15(10-8-13)21-18-19-12-11-16(22-18)20-14-5-3-4-6-14/h7-12,14H,2-6H2,1H3,(H2,19,20,21,22) |
| InChIKey | AEXBJSLMHGWIOG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |