C19H26N4O — CID 112899906
4-N-cycloheptyl-2-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112899906) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-N-cycloheptyl-2-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cycloheptyl-2-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899906 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 4-N-cycloheptyl-2-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2nccc(NC3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-2-24-17-11-9-16(10-12-17)22-19-20-14-13-18(23-19)21-15-7-5-3-4-6-8-15/h9-15H,2-8H2,1H3,(H2,20,21,22,23) |
| InChIKey | GDQJYFRLZUJCBY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |