C22H27N3O3 — CID 109175107
ethyl 4-[[2-(cycloheptylamino)pyridine-4-carbonyl]amino]benzoate (PubChem CID 109175107) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is ethyl 4-[[2-(cycloheptylamino)pyridine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(cycloheptylamino)pyridine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109175107 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | ethyl 4-[[2-(cycloheptylamino)pyridine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccnc(NC3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-2-28-22(27)16-9-11-19(12-10-16)25-21(26)17-13-14-23-20(15-17)24-18-7-5-3-4-6-8-18/h9-15,18H,2-8H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | QJBXIXGEBMRJBK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |