C14H17ClN4O2 — CID 71786088
ethyl 4-[(4-amino-6-methylpyrimidin-2-yl)amino]benzoate;hydrochloride (PubChem CID 71786088) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is ethyl 4-[(4-amino-6-methylpyrimidin-2-yl)amino]benzoate;hydrochloride.
| Compound Name | ethyl 4-[(4-amino-6-methylpyrimidin-2-yl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 71786088 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | ethyl 4-[(4-amino-6-methylpyrimidin-2-yl)amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(Nc2nc(C)cc(N)n2)cc1.Cl |
| InChI | InChI=1S/C14H16N4O2.ClH/c1-3-20-13(19)10-4-6-11(7-5-10)17-14-16-9(2)8-12(15)18-14;/h4-8H,3H2,1-2H3,(H3,15,16,17,18);1H |
| InChIKey | JDEDDYDONGJLHW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |