C23H26N4O2 — CID 112932104
ethyl 4-[[4-(N-ethyl-3-methylanilino)-6-methylpyrimidin-2-yl]amino]benzoate (PubChem CID 112932104) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is ethyl 4-[[4-(N-ethyl-3-methylanilino)-6-methylpyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(N-ethyl-3-methylanilino)-6-methylpyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112932104 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | ethyl 4-[[4-(N-ethyl-3-methylanilino)-6-methylpyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(C)cc(N(CC)c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-5-27(20-9-7-8-16(3)14-20)21-15-17(4)24-23(26-21)25-19-12-10-18(11-13-19)22(28)29-6-2/h7-15H,5-6H2,1-4H3,(H,24,25,26) |
| InChIKey | ONFUEXOBSUDOMK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |