C22H24N4O2 — CID 112920140
ethyl 4-[[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112920140) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112920140 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | ethyl 4-[[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(C)cc(NCCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-3-28-21(27)18-9-11-19(12-10-18)25-22-24-16(2)15-20(26-22)23-14-13-17-7-5-4-6-8-17/h4-12,15H,3,13-14H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | BSSIZWLYUJQRNR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |