C22H24N4O2 — CID 112899332
ethyl 4-[[4-(3-phenylpropylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112899332) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[[4-(3-phenylpropylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(3-phenylpropylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112899332 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | ethyl 4-[[4-(3-phenylpropylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nccc(NCCCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-2-28-21(27)18-10-12-19(13-11-18)25-22-24-16-14-20(26-22)23-15-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-14,16H,2,6,9,15H2,1H3,(H2,23,24,25,26) |
| InChIKey | JFAVLGAEKYOTAO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|