C18H25N5O2 — CID 112913096
ethyl 4-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 112913096) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112913096 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl 4-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cc(C)nc(NCCN(C)C)n2)cc1 |
| InChI | InChI=1S/C18H25N5O2/c1-5-25-17(24)14-6-8-15(9-7-14)21-16-12-13(2)20-18(22-16)19-10-11-23(3)4/h6-9,12H,5,10-11H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | LSMNJJYEUGYKEC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |