C17H23N5O2 — CID 112913072
methyl 3-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 112913072) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 3-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112913072 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | methyl 3-[[2-[2-(dimethylamino)ethylamino]-6-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cc(C)nc(NCCN(C)C)n2)c1 |
| InChI | InChI=1S/C17H23N5O2/c1-12-10-15(21-17(19-12)18-8-9-22(2)3)20-14-7-5-6-13(11-14)16(23)24-4/h5-7,10-11H,8-9H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | ZHLSRUZKRYPKCD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |