C17H25N5 — CID 112913671
2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(3-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 112913671) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(3-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(3-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112913671 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(3-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(Nc2cc(C)nc(NCCCN(C)C)n2)c1 |
| InChI | InChI=1S/C17H25N5/c1-13-7-5-8-15(11-13)20-16-12-14(2)19-17(21-16)18-9-6-10-22(3)4/h5,7-8,11-12H,6,9-10H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | IFJXWHLESMGXLU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|