C16H22BrN5 — CID 112913567
2-N-(3-bromophenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 112913567) has the molecular formula C16H22BrN5 and a molecular weight of 364.29 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-bromophenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112913567 |
| Molecular Formula | C16H22BrN5 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-N-(3-bromophenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCCN(C)C)nc(Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C16H22BrN5/c1-12-10-15(18-8-5-9-22(2)3)21-16(19-12)20-14-7-4-6-13(17)11-14/h4,6-7,10-11H,5,8-9H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | LOHJKMKHKWNENC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|