C15H19BrN4O — CID 112911841
2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 112911841) has the molecular formula C15H19BrN4O and a molecular weight of 351.25 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112911841 |
| Molecular Formula | C15H19BrN4O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-N-(3-bromophenyl)-4-N-(3-methoxypropyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | COCCCNc1cc(C)nc(Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H19BrN4O/c1-11-9-14(17-7-4-8-21-2)20-15(18-11)19-13-6-3-5-12(16)10-13/h3,5-6,9-10H,4,7-8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | BKBKUDXBXJQLEF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|