C20H31N5 — CID 112913514
2-N-(2,6-diethylphenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 112913514) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-N-(2,6-diethylphenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,6-diethylphenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112913514 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 2-N-(2,6-diethylphenyl)-4-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | CCc1cccc(CC)c1Nc1nc(C)cc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C20H31N5/c1-6-16-10-8-11-17(7-2)19(16)24-20-22-15(3)14-18(23-20)21-12-9-13-25(4)5/h8,10-11,14H,6-7,9,12-13H2,1-5H3,(H2,21,22,23,24) |
| InChIKey | ZIFQIHRFENMRAN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|