C21H33N7 — CID 112913561
4-N-[3-(dimethylamino)propyl]-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 112913561) has the molecular formula C21H33N7 and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112913561 |
| Molecular Formula | C21H33N7 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCCN(C)C)nc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C21H33N7/c1-17-16-20(22-10-5-11-26(2)3)25-21(23-17)24-18-6-8-19(9-7-18)28-14-12-27(4)13-15-28/h6-9,16H,5,10-15H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | KNVZCDWLDDRLIF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|