C23H28N6 — CID 112927535
4-N,6-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 112927535) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-N,6-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N,6-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112927535 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 4-N,6-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(N(C)c2ccccc2)nc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C23H28N6/c1-18-17-22(28(3)20-7-5-4-6-8-20)26-23(24-18)25-19-9-11-21(12-10-19)29-15-13-27(2)14-16-29/h4-12,17H,13-16H2,1-3H3,(H,24,25,26) |
| InChIKey | ZOHGIRALXOYYDP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|