C23H29N7O2S — CID 167418271
N-methyl-3-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 167418271) has the molecular formula C23H29N7O2S and a molecular weight of 467.60 g/mol. Its IUPAC name is N-methyl-3-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-methyl-3-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 167418271 |
| Molecular Formula | C23H29N7O2S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-methyl-3-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(N(C)c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)c1 |
| InChI | InChI=1S/C23H29N7O2S/c1-24-33(31,32)21-6-4-5-20(17-21)29(3)22-11-12-25-23(27-22)26-18-7-9-19(10-8-18)30-15-13-28(2)14-16-30/h4-12,17,24H,13-16H2,1-3H3,(H,25,26,27) |
| InChIKey | KFMZITRQFXUOQR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|