C25H31BrN6O2S — CID 67094133
5-bromo-4-N-(3-tert-butylsulfonylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 67094133) has the molecular formula C25H31BrN6O2S and a molecular weight of 559.53 g/mol. Its IUPAC name is 5-bromo-4-N-(3-tert-butylsulfonylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(3-tert-butylsulfonylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67094133 |
| Molecular Formula | C25H31BrN6O2S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 5-bromo-4-N-(3-tert-butylsulfonylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Br)c(Nc4cccc(S(=O)(=O)C(C)(C)C)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C25H31BrN6O2S/c1-25(2,3)35(33,34)21-7-5-6-19(16-21)28-23-22(26)17-27-24(30-23)29-18-8-10-20(11-9-18)32-14-12-31(4)13-15-32/h5-11,16-17H,12-15H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | RUEGEUYXVOPZLM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|