C28H37N7O2S — CID 58412665
5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-[3-(piperidin-4-ylmethylsulfonyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 58412665) has the molecular formula C28H37N7O2S and a molecular weight of 535.72 g/mol. Its IUPAC name is 5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-[3-(piperidin-4-ylmethylsulfonyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-[3-(piperidin-4-ylmethylsulfonyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58412665 |
| Molecular Formula | C28H37N7O2S |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-[3-(piperidin-4-ylmethylsulfonyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cccc(S(=O)(=O)CC2CCNCC2)c1 |
| InChI | InChI=1S/C28H37N7O2S/c1-21-19-30-28(32-23-6-8-25(9-7-23)35-16-14-34(2)15-17-35)33-27(21)31-24-4-3-5-26(18-24)38(36,37)20-22-10-12-29-13-11-22/h3-9,18-19,22,29H,10-17,20H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | FKGHYCONIFWEQT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|