C28H36N6O — CID 58412707
3,3-dimethyl-1-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]butan-1-one (PubChem CID 58412707) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]butan-1-one |
|---|---|
| PubChem CID | 58412707 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 3,3-dimethyl-1-[3-[[5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]butan-1-one |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cccc(C(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C28H36N6O/c1-20-19-29-27(31-22-9-11-24(12-10-22)34-15-13-33(5)14-16-34)32-26(20)30-23-8-6-7-21(17-23)25(35)18-28(2,3)4/h6-12,17,19H,13-16,18H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | SKDLAZRPYNLDEE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|