C25H33N7OS — CID 71196208
N-tert-butyl-3-[[5-methyl-2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]amino]benzenesulfinamide (PubChem CID 71196208) has the molecular formula C25H33N7OS and a molecular weight of 479.65 g/mol. Its IUPAC name is N-tert-butyl-3-[[5-methyl-2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]amino]benzenesulfinamide.
| Compound Name | N-tert-butyl-3-[[5-methyl-2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]amino]benzenesulfinamide |
|---|---|
| PubChem CID | 71196208 |
| Molecular Formula | C25H33N7OS |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-tert-butyl-3-[[5-methyl-2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]amino]benzenesulfinamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCNCC3)cc2)nc1Nc1cccc(S(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C25H33N7OS/c1-18-17-27-24(29-19-8-10-21(11-9-19)32-14-12-26-13-15-32)30-23(18)28-20-6-5-7-22(16-20)34(33)31-25(2,3)4/h5-11,16-17,26,31H,12-15H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | ONNXQUJVKYYWMH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|