C26H32F3N7O2S — CID 44815909
N-tert-butyl-3-[[5-methyl-2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 44815909) has the molecular formula C26H32F3N7O2S and a molecular weight of 563.65 g/mol. Its IUPAC name is N-tert-butyl-3-[[5-methyl-2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-tert-butyl-3-[[5-methyl-2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 44815909 |
| Molecular Formula | C26H32F3N7O2S |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | N-tert-butyl-3-[[5-methyl-2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCNCC3)c(C(F)(F)F)c2)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C26H32F3N7O2S/c1-17-16-31-24(33-19-8-9-22(21(15-19)26(27,28)29)36-12-10-30-11-13-36)34-23(17)32-18-6-5-7-20(14-18)39(37,38)35-25(2,3)4/h5-9,14-16,30,35H,10-13H2,1-4H3,(H2,31,32,33,34) |
| InChIKey | VTXOPNYOXAQJET-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|