C27H34N8O2S — CID 134130282
N-tert-butyl-3-[[5-cyano-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 134130282) has the molecular formula C27H34N8O2S and a molecular weight of 534.69 g/mol. Its IUPAC name is N-tert-butyl-3-[[5-cyano-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-tert-butyl-3-[[5-cyano-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 134130282 |
| Molecular Formula | C27H34N8O2S |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | N-tert-butyl-3-[[5-cyano-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | Cc1cc(Nc2ncc(C#N)c(Nc3cccc(S(=O)(=O)NC(C)(C)C)c3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C27H34N8O2S/c1-19-15-22(9-10-24(19)35-13-11-34(5)12-14-35)31-26-29-18-20(17-28)25(32-26)30-21-7-6-8-23(16-21)38(36,37)33-27(2,3)4/h6-10,15-16,18,33H,11-14H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | BSPOXGNPEWSHFF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|