C27H26N6 — CID 169275281
4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]benzonitrile (PubChem CID 169275281) has the molecular formula C27H26N6 and a molecular weight of 434.55 g/mol. Its IUPAC name is 4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]benzonitrile.
| Compound Name | 4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 169275281 |
| Molecular Formula | C27H26N6 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]benzonitrile |
| SMILES | Cc1cc(Nc2ncc3cccc(-c4ccc(C#N)cc4)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C27H26N6/c1-19-16-23(10-11-25(19)33-14-12-32(2)13-15-33)30-27-29-18-22-4-3-5-24(26(22)31-27)21-8-6-20(17-28)7-9-21/h3-11,16,18H,12-15H2,1-2H3,(H,29,30,31) |
| InChIKey | MKCVVHUHRXRIIM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|