C28H32N6O4S2 — CID 169275307
N-[4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]phenyl]-N-methylsulfonylmethanesulfonamide (PubChem CID 169275307) has the molecular formula C28H32N6O4S2 and a molecular weight of 580.74 g/mol. Its IUPAC name is N-[4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]phenyl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]phenyl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 169275307 |
| Molecular Formula | C28H32N6O4S2 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | N-[4-[2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]phenyl]-N-methylsulfonylmethanesulfonamide |
| SMILES | Cc1cc(Nc2ncc3cccc(-c4ccc(N(S(C)(=O)=O)S(C)(=O)=O)cc4)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H32N6O4S2/c1-20-18-23(10-13-26(20)33-16-14-32(2)15-17-33)30-28-29-19-22-6-5-7-25(27(22)31-28)21-8-11-24(12-9-21)34(39(3,35)36)40(4,37)38/h5-13,18-19H,14-17H2,1-4H3,(H,29,30,31) |
| InChIKey | CAIFAKJNTILKTD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|