C22H19N3O4S2 — CID 175553544
N,8-bis(4-methylsulfonylphenyl)quinazolin-2-amine (PubChem CID 175553544) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N,8-bis(4-methylsulfonylphenyl)quinazolin-2-amine.
| Compound Name | N,8-bis(4-methylsulfonylphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 175553544 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N,8-bis(4-methylsulfonylphenyl)quinazolin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncc3cccc(-c4ccc(S(C)(=O)=O)cc4)c3n2)cc1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-30(26,27)18-10-6-15(7-11-18)20-5-3-4-16-14-23-22(25-21(16)20)24-17-8-12-19(13-9-17)31(2,28)29/h3-14H,1-2H3,(H,23,24,25) |
| InChIKey | GXIBNVKMLMKNLG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |